C14H24 — CID 175928717
4,4,7,7-tetramethyl-1,2,3,5,6,8-hexahydronaphthalene (PubChem CID 175928717) has the molecular formula C14H24 and a molecular weight of 192.35 g/mol. Its IUPAC name is 4,4,7,7-tetramethyl-1,2,3,5,6,8-hexahydronaphthalene.
| Compound Name | 4,4,7,7-tetramethyl-1,2,3,5,6,8-hexahydronaphthalene |
|---|---|
| PubChem CID | 175928717 |
| Molecular Formula | C14H24 |
| Molecular Weight | 192.35 g/mol |
| Exact Mass | 192.19 |
| IUPAC Name | 4,4,7,7-tetramethyl-1,2,3,5,6,8-hexahydronaphthalene |
| SMILES | CC1(C)CCC2=C(CCCC2(C)C)C1 |
| InChI | InChI=1S/C14H24/c1-13(2)9-7-12-11(10-13)6-5-8-14(12,3)4/h5-10H2,1-4H3 |
| InChIKey | QKHJOFFTIQCUGD-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.35 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|