C11H18O — CID 130128432
6,6-dimethyl-1,2,3,4,5,7-hexahydroinden-2-ol (PubChem CID 130128432) has the molecular formula C11H18O and a molecular weight of 166.26 g/mol. Its IUPAC name is 6,6-dimethyl-1,2,3,4,5,7-hexahydroinden-2-ol.
| Compound Name | 6,6-dimethyl-1,2,3,4,5,7-hexahydroinden-2-ol |
|---|---|
| PubChem CID | 130128432 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | 6,6-dimethyl-1,2,3,4,5,7-hexahydroinden-2-ol |
| SMILES | CC1(C)CCC2=C(CC(O)C2)C1 |
| InChI | InChI=1S/C11H18O/c1-11(2)4-3-8-5-10(12)6-9(8)7-11/h10,12H,3-7H2,1-2H3 |
| InChIKey | FQKSXSXPOGXNLC-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|