C18H25FO — CID 22950893
17-fluoro-13-methyl-1,2,3,4,6,7,8,9,11,12,14,15-dodecahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 22950893) has the molecular formula C18H25FO and a molecular weight of 276.39 g/mol. Its IUPAC name is 17-fluoro-13-methyl-1,2,3,4,6,7,8,9,11,12,14,15-dodecahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | 17-fluoro-13-methyl-1,2,3,4,6,7,8,9,11,12,14,15-dodecahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 22950893 |
| Molecular Formula | C18H25FO |
| Molecular Weight | 276.39 g/mol |
| Exact Mass | 276.19 |
| IUPAC Name | 17-fluoro-13-methyl-1,2,3,4,6,7,8,9,11,12,14,15-dodecahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | CC12CCC3C4=C(CCC3C1CC=C2F)CC(O)CC4 |
| InChI | InChI=1S/C18H25FO/c1-18-9-8-14-13-5-3-12(20)10-11(13)2-4-15(14)16(18)6-7-17(18)19/h7,12,14-16,20H,2-6,8-10H2,1H3 |
| InChIKey | DNYZRWXXTXTBDH-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.39 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|