C20H30O3 — CID 89007216
(13S)-3,3-dimethoxy-13-methyl-2,4,6,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-ol (PubChem CID 89007216) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is (13S)-3,3-dimethoxy-13-methyl-2,4,6,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-ol.
| Compound Name | (13S)-3,3-dimethoxy-13-methyl-2,4,6,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 89007216 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | (13S)-3,3-dimethoxy-13-methyl-2,4,6,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-ol |
| SMILES | COC1(OC)CCC2=C(CCC3C2CC[C@]2(C)C(O)=CCC32)C1 |
| InChI | InChI=1S/C20H30O3/c1-19-10-8-15-14-9-11-20(22-2,23-3)12-13(14)4-5-16(15)17(19)6-7-18(19)21/h7,15-17,21H,4-6,8-12H2,1-3H3/t15?,16?,17?,19-/m0/s1 |
| InChIKey | UJDBWMVAGMZTRS-QMUDONBSSA-N |
| XLogP | 4.74 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|