C22H32O3 — CID 59617863
(13S)-3,3-dimethoxy-13-methylspiro[2,4,6,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthrene-16,1'-cyclopropane]-17-one (PubChem CID 59617863) has the molecular formula C22H32O3 and a molecular weight of 344.50 g/mol. Its IUPAC name is (13S)-3,3-dimethoxy-13-methylspiro[2,4,6,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthrene-16,1'-cyclopropane]-17-one.
| Compound Name | (13S)-3,3-dimethoxy-13-methylspiro[2,4,6,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthrene-16,1'-cyclopropane]-17-one |
|---|---|
| PubChem CID | 59617863 |
| Molecular Formula | C22H32O3 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | (13S)-3,3-dimethoxy-13-methylspiro[2,4,6,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthrene-16,1'-cyclopropane]-17-one |
| SMILES | COC1(OC)CCC2=C(CCC3C2CC[C@]2(C)C(=O)C4(CC4)CC32)C1 |
| InChI | InChI=1S/C22H32O3/c1-20-8-6-16-15-7-9-22(24-2,25-3)12-14(15)4-5-17(16)18(20)13-21(10-11-21)19(20)23/h16-18H,4-13H2,1-3H3/t16?,17?,18?,20-/m0/s1 |
| InChIKey | HEWQLGGECUJHHU-MPTUAUJUSA-N |
| XLogP | 4.65 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|