C25H38O4 — CID 89097584
17-[(Z)-3-hydroxyprop-1-enyl]-3,3-dimethoxy-13-methylspiro[2,4,6,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthrene-16,1'-cyclopropane]-17-ol (PubChem CID 89097584) has the molecular formula C25H38O4 and a molecular weight of 402.58 g/mol. Its IUPAC name is 17-[(Z)-3-hydroxyprop-1-enyl]-3,3-dimethoxy-13-methylspiro[2,4,6,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthrene-16,1'-cyclopropane]-17-ol.
| Compound Name | 17-[(Z)-3-hydroxyprop-1-enyl]-3,3-dimethoxy-13-methylspiro[2,4,6,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthrene-16,1'-cyclopropane]-17-ol |
|---|---|
| PubChem CID | 89097584 |
| Molecular Formula | C25H38O4 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.28 |
| IUPAC Name | 17-[(Z)-3-hydroxyprop-1-enyl]-3,3-dimethoxy-13-methylspiro[2,4,6,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthrene-16,1'-cyclopropane]-17-ol |
| SMILES | COC1(OC)CCC2=C(CCC3C2CCC2(C)C3CC3(CC3)C2(O)/C=C\CO)C1 |
| InChI | InChI=1S/C25H38O4/c1-22-10-7-19-18-8-11-24(28-2,29-3)15-17(18)5-6-20(19)21(22)16-23(12-13-23)25(22,27)9-4-14-26/h4,9,19-21,26-27H,5-8,10-16H2,1-3H3/b9-4- |
| InChIKey | FTZRGNZBRKMWST-WTKPLQERSA-N |
| XLogP | 4.36 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|