C24H34O4 — CID 70893519
(1'R,2'R,3'R,5'R,6'S,7'S,10'S)-6'-[(Z)-3-hydroxyprop-1-enyl]-7'-methylspiro[1,3-dioxolane-2,14'-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-11(16)-ene]-6'-ol (PubChem CID 70893519) has the molecular formula C24H34O4 and a molecular weight of 386.53 g/mol. Its IUPAC name is (1'R,2'R,3'R,5'R,6'S,7'S,10'S)-6'-[(Z)-3-hydroxyprop-1-enyl]-7'-methylspiro[1,3-dioxolane-2,14'-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-11(16)-ene]-6'-ol.
| Compound Name | (1'R,2'R,3'R,5'R,6'S,7'S,10'S)-6'-[(Z)-3-hydroxyprop-1-enyl]-7'-methylspiro[1,3-dioxolane-2,14'-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-11(16)-ene]-6'-ol |
|---|---|
| PubChem CID | 70893519 |
| Molecular Formula | C24H34O4 |
| Molecular Weight | 386.53 g/mol |
| Exact Mass | 386.25 |
| IUPAC Name | (1'R,2'R,3'R,5'R,6'S,7'S,10'S)-6'-[(Z)-3-hydroxyprop-1-enyl]-7'-methylspiro[1,3-dioxolane-2,14'-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-11(16)-ene]-6'-ol |
| SMILES | C[C@]12CC[C@@H]3C4=C(CC[C@H]3[C@@H]1[C@H]1C[C@H]1[C@@]2(O)/C=C\CO)CC1(CC4)OCCO1 |
| InChI | InChI=1S/C24H34O4/c1-22-8-5-17-16-6-9-23(27-11-12-28-23)14-15(16)3-4-18(17)21(22)19-13-20(19)24(22,26)7-2-10-25/h2,7,17-21,25-26H,3-6,8-14H2,1H3/b7-2-/t17-,18-,19+,20-,21-,22+,24+/m1/s1 |
| InChIKey | AZVARXAJENKPNR-RXXYNSOKSA-N |
| XLogP | 3.58 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.53 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|