C28H34O5 — CID 91204508
2-[(13R)-17-oxospiro[1,2,4,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-13-yl]ethyl benzoate (PubChem CID 91204508) has the molecular formula C28H34O5 and a molecular weight of 450.58 g/mol. Its IUPAC name is 2-[(13R)-17-oxospiro[1,2,4,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-13-yl]ethyl benzoate.
| Compound Name | 2-[(13R)-17-oxospiro[1,2,4,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-13-yl]ethyl benzoate |
|---|---|
| PubChem CID | 91204508 |
| Molecular Formula | C28H34O5 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.24 |
| IUPAC Name | 2-[(13R)-17-oxospiro[1,2,4,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-13-yl]ethyl benzoate |
| SMILES | O=C(OCC[C@]12CCC3C4=C(CCC3C1CCC2=O)CC1(CC4)OCCO1)c1ccccc1 |
| InChI | InChI=1S/C28H34O5/c29-25-9-8-24-23-7-6-20-18-28(32-16-17-33-28)13-11-21(20)22(23)10-12-27(24,25)14-15-31-26(30)19-4-2-1-3-5-19/h1-5,22-24H,6-18H2/t22?,23?,24?,27-/m1/s1 |
| InChIKey | KEPOBVSFHDATOE-REXMHCTCSA-N |
| XLogP | 5.24 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|