C21H30O3 — CID 66867509
(8R,9S,13S,14S)-3,3-dimethoxy-13-methyl-16-methylidene-2,4,6,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-one (PubChem CID 66867509) has the molecular formula C21H30O3 and a molecular weight of 330.47 g/mol. Its IUPAC name is (8R,9S,13S,14S)-3,3-dimethoxy-13-methyl-16-methylidene-2,4,6,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (8R,9S,13S,14S)-3,3-dimethoxy-13-methyl-16-methylidene-2,4,6,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 66867509 |
| Molecular Formula | C21H30O3 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | (8R,9S,13S,14S)-3,3-dimethoxy-13-methyl-16-methylidene-2,4,6,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-one |
| SMILES | C=C1C[C@H]2[C@@H]3CCC4=C(CCC(OC)(OC)C4)[C@H]3CC[C@]2(C)C1=O |
| InChI | InChI=1S/C21H30O3/c1-13-11-18-17-6-5-14-12-21(23-3,24-4)10-8-15(14)16(17)7-9-20(18,2)19(13)22/h16-18H,1,5-12H2,2-4H3/t16-,17-,18+,20+/m1/s1 |
| InChIKey | SCCNGIIJJBIBQG-XSYGEPLQSA-N |
| XLogP | 4.43 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|