C26H38 — CID 18705425
2,4,4-trimethyl-3-[2-(2,7,7-trimethyl-3,4,5,6-tetrahydroinden-1-yl)ethyl]-1,5,6,7-tetrahydroindene (PubChem CID 18705425) has the molecular formula C26H38 and a molecular weight of 350.59 g/mol. Its IUPAC name is 2,4,4-trimethyl-3-[2-(2,7,7-trimethyl-3,4,5,6-tetrahydroinden-1-yl)ethyl]-1,5,6,7-tetrahydroindene.
| Compound Name | 2,4,4-trimethyl-3-[2-(2,7,7-trimethyl-3,4,5,6-tetrahydroinden-1-yl)ethyl]-1,5,6,7-tetrahydroindene |
|---|---|
| PubChem CID | 18705425 |
| Molecular Formula | C26H38 |
| Molecular Weight | 350.59 g/mol |
| Exact Mass | 350.30 |
| IUPAC Name | 2,4,4-trimethyl-3-[2-(2,7,7-trimethyl-3,4,5,6-tetrahydroinden-1-yl)ethyl]-1,5,6,7-tetrahydroindene |
| SMILES | CC1=C(CCC2=C(C)CC3=C2C(C)(C)CCC3)C2=C(CCCC2(C)C)C1 |
| InChI | InChI=1S/C26H38/c1-17-15-19-9-7-13-25(3,4)23(19)21(17)11-12-22-18(2)16-20-10-8-14-26(5,6)24(20)22/h7-16H2,1-6H3 |
| InChIKey | QTXIWEZDMVXEQP-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.59 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |