C11H21IO — CID 134971686
(2R,4R,5S)-5-(2-iodoethyl)-2,4-dimethyl-2-propyloxolane (PubChem CID 134971686) has the molecular formula C11H21IO and a molecular weight of 296.19 g/mol. Its IUPAC name is (2R,4R,5S)-5-(2-iodoethyl)-2,4-dimethyl-2-propyloxolane.
| Compound Name | (2R,4R,5S)-5-(2-iodoethyl)-2,4-dimethyl-2-propyloxolane |
|---|---|
| PubChem CID | 134971686 |
| Molecular Formula | C11H21IO |
| Molecular Weight | 296.19 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | (2R,4R,5S)-5-(2-iodoethyl)-2,4-dimethyl-2-propyloxolane |
| SMILES | CCC[C@]1(C)C[C@@H](C)[C@H](CCI)O1 |
| InChI | InChI=1S/C11H21IO/c1-4-6-11(3)8-9(2)10(13-11)5-7-12/h9-10H,4-8H2,1-3H3/t9-,10+,11-/m1/s1 |
| InChIKey | IJLAARAHRXYAQM-OUAUKWLOSA-N |
| XLogP | 3.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.19 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|