C21H26O7 — CID 134972083
[2-(hydroxymethyl)-3,5-dimethoxyphenyl]-[2-(2-methoxyethoxymethoxymethyl)phenyl]methanone (PubChem CID 134972083) has the molecular formula C21H26O7 and a molecular weight of 390.43 g/mol. Its IUPAC name is [2-(hydroxymethyl)-3,5-dimethoxyphenyl]-[2-(2-methoxyethoxymethoxymethyl)phenyl]methanone.
| Compound Name | [2-(hydroxymethyl)-3,5-dimethoxyphenyl]-[2-(2-methoxyethoxymethoxymethyl)phenyl]methanone |
|---|---|
| PubChem CID | 134972083 |
| Molecular Formula | C21H26O7 |
| Molecular Weight | 390.43 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | [2-(hydroxymethyl)-3,5-dimethoxyphenyl]-[2-(2-methoxyethoxymethoxymethyl)phenyl]methanone |
| SMILES | COCCOCOCc1ccccc1C(=O)c1cc(OC)cc(OC)c1CO |
| InChI | InChI=1S/C21H26O7/c1-24-8-9-27-14-28-13-15-6-4-5-7-17(15)21(23)18-10-16(25-2)11-20(26-3)19(18)12-22/h4-7,10-11,22H,8-9,12-14H2,1-3H3 |
| InChIKey | GFLBNORBEJSNGA-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.43 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|