C28H31NO4Si — CID 134972243
[(2S,3aR,7R,7aR)-5-oxido-2-phenyl-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-ium-7-yl]oxy-tert-butyl-diphenylsilane (PubChem CID 134972243) has the molecular formula C28H31NO4Si and a molecular weight of 473.65 g/mol. Its IUPAC name is [(2S,3aR,7R,7aR)-5-oxido-2-phenyl-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-ium-7-yl]oxy-tert-butyl-diphenylsilane.
| Compound Name | [(2S,3aR,7R,7aR)-5-oxido-2-phenyl-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-ium-7-yl]oxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 134972243 |
| Molecular Formula | C28H31NO4Si |
| Molecular Weight | 473.65 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | [(2S,3aR,7R,7aR)-5-oxido-2-phenyl-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-ium-7-yl]oxy-tert-butyl-diphenylsilane |
| SMILES | CC(C)(C)[Si](O[C@@H]1C=[N+]([O-])C[C@H]2O[C@H](c3ccccc3)O[C@@H]12)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H31NO4Si/c1-28(2,3)34(22-15-9-5-10-16-22,23-17-11-6-12-18-23)33-25-20-29(30)19-24-26(25)32-27(31-24)21-13-7-4-8-14-21/h4-18,20,24-27H,19H2,1-3H3/t24-,25-,26-,27+/m1/s1 |
| InChIKey | WBVQDLFEYORGNT-CWTOASCOSA-N |
| XLogP | 4.01 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.65 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|