C27H29NO4 — CID 15431237
(2S,3R,4R,5R)-2-methyl-1-oxido-3,4,5-tris(phenylmethoxy)-2,3,4,5-tetrahydropyridin-1-ium (PubChem CID 15431237) has the molecular formula C27H29NO4 and a molecular weight of 431.53 g/mol. Its IUPAC name is (2S,3R,4R,5R)-2-methyl-1-oxido-3,4,5-tris(phenylmethoxy)-2,3,4,5-tetrahydropyridin-1-ium.
| Compound Name | (2S,3R,4R,5R)-2-methyl-1-oxido-3,4,5-tris(phenylmethoxy)-2,3,4,5-tetrahydropyridin-1-ium |
|---|---|
| PubChem CID | 15431237 |
| Molecular Formula | C27H29NO4 |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | (2S,3R,4R,5R)-2-methyl-1-oxido-3,4,5-tris(phenylmethoxy)-2,3,4,5-tetrahydropyridin-1-ium |
| SMILES | C[C@H]1[C@@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)C=[N+]1[O-] |
| InChI | InChI=1S/C27H29NO4/c1-21-26(31-19-23-13-7-3-8-14-23)27(32-20-24-15-9-4-10-16-24)25(17-28(21)29)30-18-22-11-5-2-6-12-22/h2-17,21,25-27H,18-20H2,1H3/t21-,25+,26+,27-/m0/s1 |
| InChIKey | HKDXUGYTRUPQNP-XVZMSMGLSA-N |
| XLogP | 4.73 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|