methyl 3-benzylsulfanyl-2-(1,3-dioxoisoindol-2-yl)propanoate

C19H17NO4S — CID 134972369

IUPACmethyl 3-benzylsulfanyl-2-(1,3-dioxoisoindol-2-yl)propanoate
SMILESCOC(=O)C(CSCc1ccccc1)N1C(=O)c2ccccc2C1=O
InChIInChI=1S/C19H17NO4S/c1-24-19(23)16(12-25-11-13-7-3-2-4-8-13)20-17(21)14-9-5-6-10-15(14)18(20)22/h2-10,16H,11-12H2,1H3
InChIKeyPLFISWMDBHOPFU-UHFFFAOYSA-N
MW355.42 g/mol
LogP2.76
Rot. Bonds6

About methyl 3-benzylsulfanyl-2-(1,3-dioxoisoindol-2-yl)propanoate

methyl 3-benzylsulfanyl-2-(1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 134972369) has the molecular formula C19H17NO4S and a molecular weight of 355.42 g/mol. Its IUPAC name is methyl 3-benzylsulfanyl-2-(1,3-dioxoisoindol-2-yl)propanoate.

Molecular Properties

Compound Namemethyl 3-benzylsulfanyl-2-(1,3-dioxoisoindol-2-yl)propanoate
PubChem CID134972369
Molecular FormulaC19H17NO4S
Molecular Weight355.42 g/mol
Exact Mass355.09
IUPAC Namemethyl 3-benzylsulfanyl-2-(1,3-dioxoisoindol-2-yl)propanoate
SMILESCOC(=O)C(CSCc1ccccc1)N1C(=O)c2ccccc2C1=O
InChIInChI=1S/C19H17NO4S/c1-24-19(23)16(12-25-11-13-7-3-2-4-8-13)20-17(21)14-9-5-6-10-15(14)18(20)22/h2-10,16H,11-12H2,1H3
InChIKeyPLFISWMDBHOPFU-UHFFFAOYSA-N
XLogP2.76
TPSA63.68 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms25
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500355.42
LogP ≤ 52.76
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phthalimide', 'substructure': 'N/A'}

Analyze methyl 3-benzylsulfanyl-2-(1,3-dioxoisoindol-2-yl)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-benzylsulfanyl-2-(1,3-dioxoisoindol-2-yl)propanoate?
The IUPAC name of methyl 3-benzylsulfanyl-2-(1,3-dioxoisoindol-2-yl)propanoate (CID 134972369) is methyl 3-benzylsulfanyl-2-(1,3-dioxoisoindol-2-yl)propanoate.
What is the SMILES notation for methyl 3-benzylsulfanyl-2-(1,3-dioxoisoindol-2-yl)propanoate?
The canonical SMILES for methyl 3-benzylsulfanyl-2-(1,3-dioxoisoindol-2-yl)propanoate is COC(=O)C(CSCc1ccccc1)N1C(=O)c2ccccc2C1=O.
What is the InChIKey of methyl 3-benzylsulfanyl-2-(1,3-dioxoisoindol-2-yl)propanoate?
The InChIKey is PLFISWMDBHOPFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17NO4S/c1-24-19(23)16(12-25-11-13-7-3-2-4-8-13)20-17(21)14-9-5-6-10-15(14)18(20)22/h2-10,16H,11-12H2,1H3.
What are the key properties of methyl 3-benzylsulfanyl-2-(1,3-dioxoisoindol-2-yl)propanoate?
methyl 3-benzylsulfanyl-2-(1,3-dioxoisoindol-2-yl)propanoate has a molecular weight of 355.42 g/mol, XLogP of 2.76, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-benzylsulfanyl-2-(1,3-dioxoisoindol-2-yl)propanoate is sourced from PubChem (CID 134972369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).