C20H30O5 — CID 134972723
[(1R,2S,3R,6R,7R,8S)-3-methyl-9,13-dioxo-6-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadecan-3-yl] acetate (PubChem CID 134972723) has the molecular formula C20H30O5 and a molecular weight of 350.46 g/mol. Its IUPAC name is [(1R,2S,3R,6R,7R,8S)-3-methyl-9,13-dioxo-6-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadecan-3-yl] acetate.
| Compound Name | [(1R,2S,3R,6R,7R,8S)-3-methyl-9,13-dioxo-6-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadecan-3-yl] acetate |
|---|---|
| PubChem CID | 134972723 |
| Molecular Formula | C20H30O5 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | [(1R,2S,3R,6R,7R,8S)-3-methyl-9,13-dioxo-6-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadecan-3-yl] acetate |
| SMILES | CC(=O)O[C@]1(C)CCC(C(C)C)[C@@H]2[C@H]1[C@H]1CC(=O)CCCC(=O)[C@H]2O1 |
| InChI | InChI=1S/C20H30O5/c1-11(2)14-8-9-20(4,25-12(3)21)18-16-10-13(22)6-5-7-15(23)19(24-16)17(14)18/h11,14,16-19H,5-10H2,1-4H3/t14?,16-,17-,18-,19-,20-/m1/s1 |
| InChIKey | IUBCUTMSQDBESO-YORDWOLRSA-N |
| XLogP | 3.09 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |