C26H32N2O — CID 134974164
(E)-N-[(2R,3aR,6aR)-2-(methoxymethyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-yl]-1-(5-tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaenyl)methanimine (PubChem CID 134974164) has the molecular formula C26H32N2O and a molecular weight of 388.56 g/mol. Its IUPAC name is (E)-N-[(2R,3aR,6aR)-2-(methoxymethyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-yl]-1-(5-tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaenyl)methanimine.
| Compound Name | (E)-N-[(2R,3aR,6aR)-2-(methoxymethyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-yl]-1-(5-tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaenyl)methanimine |
|---|---|
| PubChem CID | 134974164 |
| Molecular Formula | C26H32N2O |
| Molecular Weight | 388.56 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | (E)-N-[(2R,3aR,6aR)-2-(methoxymethyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-yl]-1-(5-tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaenyl)methanimine |
| SMILES | COC[C@H]1C[C@H]2CCC[C@H]2N1/N=C/c1cc2ccc1CCc1ccc(cc1)CC2 |
| InChI | InChI=1S/C26H32N2O/c1-29-18-25-16-23-3-2-4-26(23)28(25)27-17-24-15-21-10-9-19-5-7-20(8-6-19)11-13-22(24)14-12-21/h5-8,12,14-15,17,23,25-26H,2-4,9-11,13,16,18H2,1H3/b27-17+/t23-,25-,26-/m1/s1 |
| InChIKey | DQTUDHRUIDBYRJ-OCMDUDTGSA-N |
| XLogP | 4.79 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.56 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|