C24H30N2O — CID 11739971
(E)-N-[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]-1-(5-tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaenyl)ethanimine (PubChem CID 11739971) has the molecular formula C24H30N2O and a molecular weight of 362.52 g/mol. Its IUPAC name is (E)-N-[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]-1-(5-tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaenyl)ethanimine.
| Compound Name | (E)-N-[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]-1-(5-tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaenyl)ethanimine |
|---|---|
| PubChem CID | 11739971 |
| Molecular Formula | C24H30N2O |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.24 |
| IUPAC Name | (E)-N-[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]-1-(5-tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaenyl)ethanimine |
| SMILES | COC[C@H]1CCCN1/N=C(\C)c1cc2ccc1CCc1ccc(cc1)CC2 |
| InChI | InChI=1S/C24H30N2O/c1-18(25-26-15-3-4-23(26)17-27-2)24-16-21-10-9-19-5-7-20(8-6-19)11-13-22(24)14-12-21/h5-8,12,14,16,23H,3-4,9-11,13,15,17H2,1-2H3/b25-18+/t23-/m1/s1 |
| InChIKey | BUYFSCUZHYVMQN-DMUURETOSA-N |
| XLogP | 4.41 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|