C23H28N2O — CID 134974240
(E)-N-[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]-1-(5-tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaenyl)methanimine (PubChem CID 134974240) has the molecular formula C23H28N2O and a molecular weight of 348.49 g/mol. Its IUPAC name is (E)-N-[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]-1-(5-tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaenyl)methanimine.
| Compound Name | (E)-N-[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]-1-(5-tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaenyl)methanimine |
|---|---|
| PubChem CID | 134974240 |
| Molecular Formula | C23H28N2O |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | (E)-N-[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]-1-(5-tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaenyl)methanimine |
| SMILES | COC[C@H]1CCCN1/N=C/c1cc2ccc1CCc1ccc(cc1)CC2 |
| InChI | InChI=1S/C23H28N2O/c1-26-17-23-3-2-14-25(23)24-16-22-15-20-9-8-18-4-6-19(7-5-18)10-12-21(22)13-11-20/h4-7,11,13,15-16,23H,2-3,8-10,12,14,17H2,1H3/b24-16+/t23-/m1/s1 |
| InChIKey | WCILDYNPVAGCPZ-DIVQNALZSA-N |
| XLogP | 4.02 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|