About magnesium;1-benzyl-3-(2-iodoethyl)-6-phenylmethoxyindol-2-olate;iodide
magnesium;1-benzyl-3-(2-iodoethyl)-6-phenylmethoxyindol-2-olate;iodide (PubChem CID 134974609) has the molecular formula C24H21I2MgNO2
and a molecular weight of 633.55 g/mol. Its IUPAC name is magnesium;1-benzyl-3-(2-iodoethyl)-6-phenylmethoxyindol-2-olate;iodide.
Molecular Properties
| Compound Name | magnesium;1-benzyl-3-(2-iodoethyl)-6-phenylmethoxyindol-2-olate;iodide |
| PubChem CID | 134974609 |
| Molecular Formula | C24H21I2MgNO2 |
| Molecular Weight | 633.55 g/mol |
| Exact Mass | 632.95 |
| IUPAC Name | magnesium;1-benzyl-3-(2-iodoethyl)-6-phenylmethoxyindol-2-olate;iodide |
| SMILES | [I-].[Mg+2].[O-]c1c(CCI)c2ccc(OCc3ccccc3)cc2n1Cc1ccccc1 |
| InChI | InChI=1S/C24H22INO2.HI.Mg/c25-14-13-22-21-12-11-20(28-17-19-9-5-2-6-10-19)15-23(21)26(24(22)27)16-18-7-3-1-4-8-18;;/h1-12,15,27H,13-14,16-17H2;1H;/q;;+2/p-2 |
| InChIKey | MWEZEWKJSUPPKU-UHFFFAOYSA-L |
| XLogP | 1.94 |
| TPSA | 37.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 633.55 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze magnesium;1-benzyl-3-(2-iodoethyl)-6-phenylmethoxyindol-2-olate;iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;1-benzyl-3-(2-iodoethyl)-6-phenylmethoxyindol-2-olate;iodide?
The IUPAC name of magnesium;1-benzyl-3-(2-iodoethyl)-6-phenylmethoxyindol-2-olate;iodide (CID 134974609) is magnesium;1-benzyl-3-(2-iodoethyl)-6-phenylmethoxyindol-2-olate;iodide.
What is the SMILES notation for magnesium;1-benzyl-3-(2-iodoethyl)-6-phenylmethoxyindol-2-olate;iodide?
The canonical SMILES for magnesium;1-benzyl-3-(2-iodoethyl)-6-phenylmethoxyindol-2-olate;iodide is [I-].[Mg+2].[O-]c1c(CCI)c2ccc(OCc3ccccc3)cc2n1Cc1ccccc1.
What is the InChIKey of magnesium;1-benzyl-3-(2-iodoethyl)-6-phenylmethoxyindol-2-olate;iodide?
The InChIKey is MWEZEWKJSUPPKU-UHFFFAOYSA-L. The full InChI is InChI=1S/C24H22INO2.HI.Mg/c25-14-13-22-21-12-11-20(28-17-19-9-5-2-6-10-19)15-23(21)26(24(22)27)16-18-7-3-1-4-8-18;;/h1-12,15,27H,13-14,16-17H2;1H;/q;;+2/p-2.
What are the key properties of magnesium;1-benzyl-3-(2-iodoethyl)-6-phenylmethoxyindol-2-olate;iodide?
magnesium;1-benzyl-3-(2-iodoethyl)-6-phenylmethoxyindol-2-olate;iodide has a molecular weight of 633.55 g/mol, XLogP of 1.94, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;1-benzyl-3-(2-iodoethyl)-6-phenylmethoxyindol-2-olate;iodide is sourced from PubChem (CID 134974609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).