C13H17IO3 — CID 134974629
(2R,3S,5Z)-3-hydroxy-2-[(1E,3Z)-4-iodobuta-1,3-dienyl]-2,3,4,7,8,9-hexahydrooxecin-10-one (PubChem CID 134974629) has the molecular formula C13H17IO3 and a molecular weight of 348.18 g/mol. Its IUPAC name is (2R,3S,5Z)-3-hydroxy-2-[(1E,3Z)-4-iodobuta-1,3-dienyl]-2,3,4,7,8,9-hexahydrooxecin-10-one.
| Compound Name | (2R,3S,5Z)-3-hydroxy-2-[(1E,3Z)-4-iodobuta-1,3-dienyl]-2,3,4,7,8,9-hexahydrooxecin-10-one |
|---|---|
| PubChem CID | 134974629 |
| Molecular Formula | C13H17IO3 |
| Molecular Weight | 348.18 g/mol |
| Exact Mass | 348.02 |
| IUPAC Name | (2R,3S,5Z)-3-hydroxy-2-[(1E,3Z)-4-iodobuta-1,3-dienyl]-2,3,4,7,8,9-hexahydrooxecin-10-one |
| SMILES | O=C1CCC/C=C\C[C@H](O)[C@@H](/C=C/C=C\I)O1 |
| InChI | InChI=1S/C13H17IO3/c14-10-6-5-8-12-11(15)7-3-1-2-4-9-13(16)17-12/h1,3,5-6,8,10-12,15H,2,4,7,9H2/b3-1-,8-5+,10-6-/t11-,12+/m0/s1 |
| InChIKey | HVJOLXHZHBZCNW-FQMQFPFOSA-N |
| XLogP | 2.89 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.18 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|