C12H22O2 — CID 134975639
2,3,3,7-tetramethyloct-4-yne-2,7-diol (PubChem CID 134975639) has the molecular formula C12H22O2 and a molecular weight of 198.31 g/mol. Its IUPAC name is 2,3,3,7-tetramethyloct-4-yne-2,7-diol.
| Compound Name | 2,3,3,7-tetramethyloct-4-yne-2,7-diol |
|---|---|
| PubChem CID | 134975639 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | 2,3,3,7-tetramethyloct-4-yne-2,7-diol |
| SMILES | CC(C)(O)CC#CC(C)(C)C(C)(C)O |
| InChI | InChI=1S/C12H22O2/c1-10(2,12(5,6)14)8-7-9-11(3,4)13/h13-14H,9H2,1-6H3 |
| InChIKey | LBIZBTCFXSYFKI-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|