About methyl (6R)-6-acetyloxyoctadeca-7,9-diynoate
methyl (6R)-6-acetyloxyoctadeca-7,9-diynoate (PubChem CID 134977491) has the molecular formula C21H32O4
and a molecular weight of 348.48 g/mol. Its IUPAC name is methyl (6R)-6-acetyloxyoctadeca-7,9-diynoate.
Molecular Properties
| Compound Name | methyl (6R)-6-acetyloxyoctadeca-7,9-diynoate |
| PubChem CID | 134977491 |
| Molecular Formula | C21H32O4 |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | methyl (6R)-6-acetyloxyoctadeca-7,9-diynoate |
| SMILES | CCCCCCCCC#CC#C[C@@H](CCCCC(=O)OC)OC(C)=O |
| InChI | InChI=1S/C21H32O4/c1-4-5-6-7-8-9-10-11-12-13-16-20(25-19(2)22)17-14-15-18-21(23)24-3/h20H,4-10,14-15,17-18H2,1-3H3/t20-/m0/s1 |
| InChIKey | JMDVSMZEMXBMRM-FQEVSTJZSA-N |
| XLogP | 4.41 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl (6R)-6-acetyloxyoctadeca-7,9-diynoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (6R)-6-acetyloxyoctadeca-7,9-diynoate?
The IUPAC name of methyl (6R)-6-acetyloxyoctadeca-7,9-diynoate (CID 134977491) is methyl (6R)-6-acetyloxyoctadeca-7,9-diynoate.
What is the SMILES notation for methyl (6R)-6-acetyloxyoctadeca-7,9-diynoate?
The canonical SMILES for methyl (6R)-6-acetyloxyoctadeca-7,9-diynoate is CCCCCCCCC#CC#C[C@@H](CCCCC(=O)OC)OC(C)=O.
What is the InChIKey of methyl (6R)-6-acetyloxyoctadeca-7,9-diynoate?
The InChIKey is JMDVSMZEMXBMRM-FQEVSTJZSA-N. The full InChI is InChI=1S/C21H32O4/c1-4-5-6-7-8-9-10-11-12-13-16-20(25-19(2)22)17-14-15-18-21(23)24-3/h20H,4-10,14-15,17-18H2,1-3H3/t20-/m0/s1.
What are the key properties of methyl (6R)-6-acetyloxyoctadeca-7,9-diynoate?
methyl (6R)-6-acetyloxyoctadeca-7,9-diynoate has a molecular weight of 348.48 g/mol, XLogP of 4.41, 12 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (6R)-6-acetyloxyoctadeca-7,9-diynoate is sourced from PubChem (CID 134977491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).