C15H30OSi — CID 134977529
tert-butyl-(8-deuterionona-6,7-dienoxy)-dimethylsilane (PubChem CID 134977529) has the molecular formula C15H30OSi and a molecular weight of 255.50 g/mol. Its IUPAC name is tert-butyl-(8-deuterionona-6,7-dienoxy)-dimethylsilane.
| Compound Name | tert-butyl-(8-deuterionona-6,7-dienoxy)-dimethylsilane |
|---|---|
| PubChem CID | 134977529 |
| Molecular Formula | C15H30OSi |
| Molecular Weight | 255.50 g/mol |
| Exact Mass | 255.21 |
| IUPAC Name | tert-butyl-(8-deuterionona-6,7-dienoxy)-dimethylsilane |
| SMILES | [2H]C(C)=C=CCCCCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H30OSi/c1-7-8-9-10-11-12-13-14-16-17(5,6)15(2,3)4/h7,9H,10-14H2,1-6H3/i7D |
| InChIKey | YXOCZBGNWWFXMD-WHRKIXHSSA-N |
| XLogP | 5.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.50 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|