C32H56 — CID 134978478
1,3,4,5,7,8-hexatert-butyltricyclo[4.2.0.02,5]octa-3,7-diene (PubChem CID 134978478) has the molecular formula C32H56 and a molecular weight of 440.80 g/mol. Its IUPAC name is 1,3,4,5,7,8-hexatert-butyltricyclo[4.2.0.02,5]octa-3,7-diene.
| Compound Name | 1,3,4,5,7,8-hexatert-butyltricyclo[4.2.0.02,5]octa-3,7-diene |
|---|---|
| PubChem CID | 134978478 |
| Molecular Formula | C32H56 |
| Molecular Weight | 440.80 g/mol |
| Exact Mass | 440.44 |
| IUPAC Name | 1,3,4,5,7,8-hexatert-butyltricyclo[4.2.0.02,5]octa-3,7-diene |
| SMILES | CC(C)(C)C1=C(C(C)(C)C)C2(C(C)(C)C)C1C1(C(C)(C)C)C(C(C)(C)C)=C(C(C)(C)C)C21 |
| InChI | InChI=1S/C32H56/c1-25(2,3)19-21(27(7,8)9)31(29(13,14)15)23(19)32(30(16,17)18)22(28(10,11)12)20(24(31)32)26(4,5)6/h23-24H,1-18H3 |
| InChIKey | AGMVDQFWYYLQSS-UHFFFAOYSA-N |
| XLogP | 10.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.80 |
| LogP ≤ 5 | 10.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|