C11H17BBr2 — CID 134978680
dibromo-(2-butyl-4-methylcyclohexa-1,4-dien-1-yl)borane (PubChem CID 134978680) has the molecular formula C11H17BBr2 and a molecular weight of 319.88 g/mol. Its IUPAC name is dibromo-(2-butyl-4-methylcyclohexa-1,4-dien-1-yl)borane.
| Compound Name | dibromo-(2-butyl-4-methylcyclohexa-1,4-dien-1-yl)borane |
|---|---|
| PubChem CID | 134978680 |
| Molecular Formula | C11H17BBr2 |
| Molecular Weight | 319.88 g/mol |
| Exact Mass | 317.98 |
| IUPAC Name | dibromo-(2-butyl-4-methylcyclohexa-1,4-dien-1-yl)borane |
| SMILES | CCCCC1=C(B(Br)Br)CC=C(C)C1 |
| InChI | InChI=1S/C11H17BBr2/c1-3-4-5-10-8-9(2)6-7-11(10)12(13)14/h6H,3-5,7-8H2,1-2H3 |
| InChIKey | GQGFLGZSQRIAMO-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.88 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|