C20H30V — CID 173204075
bis(3-butyl-1-methylcyclopenta-1,3-diene);vanadium(2+) (PubChem CID 173204075) has the molecular formula C20H30V and a molecular weight of 321.40 g/mol. Its IUPAC name is bis(3-butyl-1-methylcyclopenta-1,3-diene);vanadium(2+).
| Compound Name | bis(3-butyl-1-methylcyclopenta-1,3-diene);vanadium(2+) |
|---|---|
| PubChem CID | 173204075 |
| Molecular Formula | C20H30V |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | bis(3-butyl-1-methylcyclopenta-1,3-diene);vanadium(2+) |
| SMILES | CCCCC1=CCC(C)=[C-]1.CCCCC1=CCC(C)=[C-]1.[V+2] |
| InChI | InChI=1S/2C10H15.V/c2*1-3-4-5-10-7-6-9(2)8-10;/h2*7H,3-6H2,1-2H3;/q2*-1;+2 |
| InChIKey | ZIOLBTGRSGYZET-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|