C8H11Ti- — CID 174601324
3-ethyl-1-methylcyclopenta-1,3-diene;titanium (PubChem CID 174601324) has the molecular formula C8H11Ti- and a molecular weight of 155.04 g/mol. Its IUPAC name is 3-ethyl-1-methylcyclopenta-1,3-diene;titanium.
| Compound Name | 3-ethyl-1-methylcyclopenta-1,3-diene;titanium |
|---|---|
| PubChem CID | 174601324 |
| Molecular Formula | C8H11Ti- |
| Molecular Weight | 155.04 g/mol |
| Exact Mass | 155.03 |
| IUPAC Name | 3-ethyl-1-methylcyclopenta-1,3-diene;titanium |
| SMILES | CCC1=CCC(C)=[C-]1.[Ti] |
| InChI | InChI=1S/C8H11.Ti/c1-3-8-5-4-7(2)6-8;/h5H,3-4H2,1-2H3;/q-1; |
| InChIKey | MOOUQSSQEJTWLG-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.04 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|