C16H22Zr — CID 173020265
bis(1-ethyl-3-methylcyclopenta-1,3-diene);zirconium(2+) (PubChem CID 173020265) has the molecular formula C16H22Zr and a molecular weight of 305.58 g/mol. Its IUPAC name is bis(1-ethyl-3-methylcyclopenta-1,3-diene);zirconium(2+).
| Compound Name | bis(1-ethyl-3-methylcyclopenta-1,3-diene);zirconium(2+) |
|---|---|
| PubChem CID | 173020265 |
| Molecular Formula | C16H22Zr |
| Molecular Weight | 305.58 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | bis(1-ethyl-3-methylcyclopenta-1,3-diene);zirconium(2+) |
| SMILES | CCC1=[C-]C(C)=CC1.CCC1=[C-]C(C)=CC1.[Zr+2] |
| InChI | InChI=1S/2C8H11.Zr/c2*1-3-8-5-4-7(2)6-8;/h2*4H,3,5H2,1-2H3;/q2*-1;+2 |
| InChIKey | BEUFMRTYNSFEGB-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.58 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|