C13H29BO3Si — CID 134978714
tert-butyl-dimethyl-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methoxy]silane (PubChem CID 134978714) has the molecular formula C13H29BO3Si and a molecular weight of 272.27 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methoxy]silane |
|---|---|
| PubChem CID | 134978714 |
| Molecular Formula | C13H29BO3Si |
| Molecular Weight | 272.27 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | tert-butyl-dimethyl-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methoxy]silane |
| SMILES | CC1(C)OB(CO[Si](C)(C)C(C)(C)C)OC1(C)C |
| InChI | InChI=1S/C13H29BO3Si/c1-11(2,3)18(8,9)15-10-14-16-12(4,5)13(6,7)17-14/h10H2,1-9H3 |
| InChIKey | IYSSUSLZTGXGIN-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.27 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|