C23H40O3Si — CID 134979447
[(1S,7S,8S,8aR)-8-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylpropanoate (PubChem CID 134979447) has the molecular formula C23H40O3Si and a molecular weight of 392.66 g/mol. Its IUPAC name is [(1S,7S,8S,8aR)-8-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylpropanoate.
| Compound Name | [(1S,7S,8S,8aR)-8-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 134979447 |
| Molecular Formula | C23H40O3Si |
| Molecular Weight | 392.66 g/mol |
| Exact Mass | 392.27 |
| IUPAC Name | [(1S,7S,8S,8aR)-8-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylpropanoate |
| SMILES | C[C@H]1C=CC2=CCC[C@H](OC(=O)C(C)(C)C)[C@@H]2[C@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H40O3Si/c1-16-13-14-17-11-10-12-19(26-21(24)22(2,3)4)20(17)18(16)15-25-27(8,9)23(5,6)7/h11,13-14,16,18-20H,10,12,15H2,1-9H3/t16-,18-,19-,20-/m0/s1 |
| InChIKey | LGMSOPNXPAZVDN-LEAZDLGRSA-N |
| XLogP | 6.12 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.66 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|