C19H30O3 — CID 134979710
methyl 6-[(3aS,6aR,7S,9aR)-6-oxo-1,2,3,3a,4,5,6a,7,8,9-decahydrocyclopenta[d]inden-7-yl]hexanoate (PubChem CID 134979710) has the molecular formula C19H30O3 and a molecular weight of 306.45 g/mol. Its IUPAC name is methyl 6-[(3aS,6aR,7S,9aR)-6-oxo-1,2,3,3a,4,5,6a,7,8,9-decahydrocyclopenta[d]inden-7-yl]hexanoate.
| Compound Name | methyl 6-[(3aS,6aR,7S,9aR)-6-oxo-1,2,3,3a,4,5,6a,7,8,9-decahydrocyclopenta[d]inden-7-yl]hexanoate |
|---|---|
| PubChem CID | 134979710 |
| Molecular Formula | C19H30O3 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | methyl 6-[(3aS,6aR,7S,9aR)-6-oxo-1,2,3,3a,4,5,6a,7,8,9-decahydrocyclopenta[d]inden-7-yl]hexanoate |
| SMILES | COC(=O)CCCCC[C@H]1CC[C@]23CCC[C@H]2CCC(=O)[C@H]13 |
| InChI | InChI=1S/C19H30O3/c1-22-17(21)8-4-2-3-6-14-11-13-19-12-5-7-15(19)9-10-16(20)18(14)19/h14-15,18H,2-13H2,1H3/t14-,15-,18-,19+/m0/s1 |
| InChIKey | OAGRUDGZVQHWER-STEAMIEHSA-N |
| XLogP | 4.29 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|