C17H26O8 — CID 134979806
triethyl (E)-2-(2-ethoxy-2-oxoethyl)but-3-ene-1,1,4-tricarboxylate (PubChem CID 134979806) has the molecular formula C17H26O8 and a molecular weight of 358.39 g/mol. Its IUPAC name is triethyl (E)-2-(2-ethoxy-2-oxoethyl)but-3-ene-1,1,4-tricarboxylate.
| Compound Name | triethyl (E)-2-(2-ethoxy-2-oxoethyl)but-3-ene-1,1,4-tricarboxylate |
|---|---|
| PubChem CID | 134979806 |
| Molecular Formula | C17H26O8 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | triethyl (E)-2-(2-ethoxy-2-oxoethyl)but-3-ene-1,1,4-tricarboxylate |
| SMILES | CCOC(=O)/C=C/C(CC(=O)OCC)C(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C17H26O8/c1-5-22-13(18)10-9-12(11-14(19)23-6-2)15(16(20)24-7-3)17(21)25-8-4/h9-10,12,15H,5-8,11H2,1-4H3/b10-9+ |
| InChIKey | HGDINVHXAMGKOG-MDZDMXLPSA-N |
| XLogP | 1.42 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|