C17H28O6 — CID 91207203
2-ethoxycarbonyl-2,3-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonyl]hept-4-enoic acid (PubChem CID 91207203) has the molecular formula C17H28O6 and a molecular weight of 328.41 g/mol. Its IUPAC name is 2-ethoxycarbonyl-2,3-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonyl]hept-4-enoic acid.
| Compound Name | 2-ethoxycarbonyl-2,3-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonyl]hept-4-enoic acid |
|---|---|
| PubChem CID | 91207203 |
| Molecular Formula | C17H28O6 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | 2-ethoxycarbonyl-2,3-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonyl]hept-4-enoic acid |
| SMILES | CCC=C(C(=O)OC(C)(C)C)C(C)C(C)(C(=O)O)C(=O)OCC |
| InChI | InChI=1S/C17H28O6/c1-8-10-12(13(18)23-16(4,5)6)11(3)17(7,14(19)20)15(21)22-9-2/h10-11H,8-9H2,1-7H3,(H,19,20) |
| InChIKey | ZMFAEANDQJCBRO-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|