C17H30O2Si — CID 134980498
2-[(1E,3E,5E)-7-hydroxy-3-methylocta-1,3,5-trienyl]-1,1,3-trimethylsilinan-2-ol (PubChem CID 134980498) has the molecular formula C17H30O2Si and a molecular weight of 294.51 g/mol. Its IUPAC name is 2-[(1E,3E,5E)-7-hydroxy-3-methylocta-1,3,5-trienyl]-1,1,3-trimethylsilinan-2-ol.
| Compound Name | 2-[(1E,3E,5E)-7-hydroxy-3-methylocta-1,3,5-trienyl]-1,1,3-trimethylsilinan-2-ol |
|---|---|
| PubChem CID | 134980498 |
| Molecular Formula | C17H30O2Si |
| Molecular Weight | 294.51 g/mol |
| Exact Mass | 294.20 |
| IUPAC Name | 2-[(1E,3E,5E)-7-hydroxy-3-methylocta-1,3,5-trienyl]-1,1,3-trimethylsilinan-2-ol |
| SMILES | CC(/C=C/C1(O)C(C)CCC[Si]1(C)C)=C\C=C\C(C)O |
| InChI | InChI=1S/C17H30O2Si/c1-14(8-6-10-16(3)18)11-12-17(19)15(2)9-7-13-20(17,4)5/h6,8,10-12,15-16,18-19H,7,9,13H2,1-5H3/b10-6+,12-11+,14-8+ |
| InChIKey | GUACYAQPBJIIML-LUXGDSJYSA-N |
| XLogP | 3.83 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.51 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|