C19H21NO6 — CID 134980540
dimethyl (1S,2R,3S)-3-[(4R)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]cyclohex-4-ene-1,2-dicarboxylate (PubChem CID 134980540) has the molecular formula C19H21NO6 and a molecular weight of 359.38 g/mol. Its IUPAC name is dimethyl (1S,2R,3S)-3-[(4R)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]cyclohex-4-ene-1,2-dicarboxylate.
| Compound Name | dimethyl (1S,2R,3S)-3-[(4R)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]cyclohex-4-ene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 134980540 |
| Molecular Formula | C19H21NO6 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | dimethyl (1S,2R,3S)-3-[(4R)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]cyclohex-4-ene-1,2-dicarboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H](C(=O)OC)CC=C[C@@H]1N1C(=O)OC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C19H21NO6/c1-24-17(21)13-9-6-10-14(16(13)18(22)25-2)20-15(11-26-19(20)23)12-7-4-3-5-8-12/h3-8,10,13-16H,9,11H2,1-2H3/t13-,14-,15-,16+/m0/s1 |
| InChIKey | TYJNFCKZBOKTME-YHUYYLMFSA-N |
| XLogP | 2.09 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|