C20H31F2O6PSSi — CID 134980622
[(1R,5R,6R)-6-(benzenesulfonyl)-5-[diethoxyphosphoryl(difluoro)methyl]cyclohex-2-en-1-yl]oxy-trimethylsilane (PubChem CID 134980622) has the molecular formula C20H31F2O6PSSi and a molecular weight of 496.59 g/mol. Its IUPAC name is [(1R,5R,6R)-6-(benzenesulfonyl)-5-[diethoxyphosphoryl(difluoro)methyl]cyclohex-2-en-1-yl]oxy-trimethylsilane.
| Compound Name | [(1R,5R,6R)-6-(benzenesulfonyl)-5-[diethoxyphosphoryl(difluoro)methyl]cyclohex-2-en-1-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 134980622 |
| Molecular Formula | C20H31F2O6PSSi |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.13 |
| IUPAC Name | [(1R,5R,6R)-6-(benzenesulfonyl)-5-[diethoxyphosphoryl(difluoro)methyl]cyclohex-2-en-1-yl]oxy-trimethylsilane |
| SMILES | CCOP(=O)(OCC)C(F)(F)[C@H]1CC=C[C@@H](O[Si](C)(C)C)[C@@H]1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H31F2O6PSSi/c1-6-26-29(23,27-7-2)20(21,22)17-14-11-15-18(28-31(3,4)5)19(17)30(24,25)16-12-9-8-10-13-16/h8-13,15,17-19H,6-7,14H2,1-5H3/t17-,18+,19+/m0/s1 |
| InChIKey | WRVJHOPFQLEAQB-IPMKNSEASA-N |
| XLogP | 5.48 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|