C16H23F2O5PS — CID 15305267
[(1S,2R)-2-[diethoxyphosphoryl(difluoro)methyl]cyclopentyl]sulfonylbenzene (PubChem CID 15305267) has the molecular formula C16H23F2O5PS and a molecular weight of 396.39 g/mol. Its IUPAC name is [(1S,2R)-2-[diethoxyphosphoryl(difluoro)methyl]cyclopentyl]sulfonylbenzene.
| Compound Name | [(1S,2R)-2-[diethoxyphosphoryl(difluoro)methyl]cyclopentyl]sulfonylbenzene |
|---|---|
| PubChem CID | 15305267 |
| Molecular Formula | C16H23F2O5PS |
| Molecular Weight | 396.39 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | [(1S,2R)-2-[diethoxyphosphoryl(difluoro)methyl]cyclopentyl]sulfonylbenzene |
| SMILES | CCOP(=O)(OCC)C(F)(F)[C@H]1CCC[C@@H]1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H23F2O5PS/c1-3-22-24(19,23-4-2)16(17,18)14-11-8-12-15(14)25(20,21)13-9-6-5-7-10-13/h5-7,9-10,14-15H,3-4,8,11-12H2,1-2H3/t14-,15-/m0/s1 |
| InChIKey | DUCWVACSFZFDHY-GJZGRUSLSA-N |
| XLogP | 4.49 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.39 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|