C14H14CrO7 — CID 134980625
carbon monoxide;[methoxy-[(1R,2S)-2-methoxycyclohex-3-en-1-yl]methylidene]chromium (PubChem CID 134980625) has the molecular formula C14H14CrO7 and a molecular weight of 346.26 g/mol. Its IUPAC name is carbon monoxide;[methoxy-[(1R,2S)-2-methoxycyclohex-3-en-1-yl]methylidene]chromium.
| Compound Name | carbon monoxide;[methoxy-[(1R,2S)-2-methoxycyclohex-3-en-1-yl]methylidene]chromium |
|---|---|
| PubChem CID | 134980625 |
| Molecular Formula | C14H14CrO7 |
| Molecular Weight | 346.26 g/mol |
| Exact Mass | 346.01 |
| IUPAC Name | carbon monoxide;[methoxy-[(1R,2S)-2-methoxycyclohex-3-en-1-yl]methylidene]chromium |
| SMILES | COC(=[Cr])[C@@H]1CCC=C[C@@H]1OC.[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+] |
| InChI | InChI=1S/C9H14O2.5CO.Cr/c1-10-7-8-5-3-4-6-9(8)11-2;5*1-2;/h4,6,8-9H,3,5H2,1-2H3;;;;;;/t8-,9-;;;;;;/m0....../s1 |
| InChIKey | IDTZEGRFVMETDZ-KFGRDHEPSA-N |
| XLogP | 1.10 |
| TPSA | 117.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.26 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|