C13H24 — CID 134980760
(3R,6R)-3-butyl-6-propan-2-ylcyclohexene (PubChem CID 134980760) has the molecular formula C13H24 and a molecular weight of 180.33 g/mol. Its IUPAC name is (3R,6R)-3-butyl-6-propan-2-ylcyclohexene.
| Compound Name | (3R,6R)-3-butyl-6-propan-2-ylcyclohexene |
|---|---|
| PubChem CID | 134980760 |
| Molecular Formula | C13H24 |
| Molecular Weight | 180.33 g/mol |
| Exact Mass | 180.19 |
| IUPAC Name | (3R,6R)-3-butyl-6-propan-2-ylcyclohexene |
| SMILES | CCCC[C@H]1C=C[C@@H](C(C)C)CC1 |
| InChI | InChI=1S/C13H24/c1-4-5-6-12-7-9-13(10-8-12)11(2)3/h7,9,11-13H,4-6,8,10H2,1-3H3/t12-,13+/m0/s1 |
| InChIKey | CPOVATCHIWUIKY-QWHCGFSZSA-N |
| XLogP | 4.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.33 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|