C20H27NO2 — CID 134980835
ethyl (1S,2R)-1-phenyl-2-piperidin-1-ylcyclohex-3-ene-1-carboxylate (PubChem CID 134980835) has the molecular formula C20H27NO2 and a molecular weight of 313.44 g/mol. Its IUPAC name is ethyl (1S,2R)-1-phenyl-2-piperidin-1-ylcyclohex-3-ene-1-carboxylate.
| Compound Name | ethyl (1S,2R)-1-phenyl-2-piperidin-1-ylcyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 134980835 |
| Molecular Formula | C20H27NO2 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | ethyl (1S,2R)-1-phenyl-2-piperidin-1-ylcyclohex-3-ene-1-carboxylate |
| SMILES | CCOC(=O)[C@]1(c2ccccc2)CCC=C[C@H]1N1CCCCC1 |
| InChI | InChI=1S/C20H27NO2/c1-2-23-19(22)20(17-11-5-3-6-12-17)14-8-7-13-18(20)21-15-9-4-10-16-21/h3,5-7,11-13,18H,2,4,8-10,14-16H2,1H3/t18-,20+/m1/s1 |
| InChIKey | SGZXCKMODRCATB-QUCCMNQESA-N |
| XLogP | 3.69 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|