About Tilidine
Tilidine (PubChem CID 30131) has the molecular formula C17H23NO2
and a molecular weight of 273.37 g/mol. Its IUPAC name is ethyl (1S,2R)-2-(dimethylamino)-1-phenylcyclohex-3-ene-1-carboxylate.
Molecular Properties
| Compound Name | Tilidine |
| PubChem CID | 30131 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.37 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | ethyl (1S,2R)-2-(dimethylamino)-1-phenylcyclohex-3-ene-1-carboxylate |
| SMILES | CCOC(=O)[C@@]1(CCC=C[C@H]1N(C)C)C2=CC=CC=C2 |
| InChI | InChI=1S/C17H23NO2/c1-4-20-16(19)17(14-10-6-5-7-11-14)13-9-8-12-15(17)18(2)3/h5-8,10-12,15H,4,9,13H2,1-3H3/t15-,17+/m1/s1 |
| InChIKey | WDEFBBTXULIOBB-WBVHZDCISA-N |
| XLogP | 3.10 |
| TPSA | 29.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | 358 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.37 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze Tilidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Tilidine?
The IUPAC name of Tilidine (CID 30131) is ethyl (1S,2R)-2-(dimethylamino)-1-phenylcyclohex-3-ene-1-carboxylate.
What is the SMILES notation for Tilidine?
The canonical SMILES for Tilidine is CCOC(=O)[C@@]1(CCC=C[C@H]1N(C)C)C2=CC=CC=C2.
What is the InChIKey of Tilidine?
The InChIKey is WDEFBBTXULIOBB-WBVHZDCISA-N. The full InChI is InChI=1S/C17H23NO2/c1-4-20-16(19)17(14-10-6-5-7-11-14)13-9-8-12-15(17)18(2)3/h5-8,10-12,15H,4,9,13H2,1-3H3/t15-,17+/m1/s1.
What are the key properties of Tilidine?
Tilidine has a molecular weight of 273.37 g/mol, XLogP of 3.10, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for Tilidine is sourced from PubChem (CID 30131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).