About Alphacetylmethadol
Alphacetylmethadol (PubChem CID 22308) has the molecular formula C23H31NO2
and a molecular weight of 353.50 g/mol. Its IUPAC name is [(3R,6R)-6-(dimethylamino)-4,4-diphenylheptan-3-yl] acetate.
Molecular Properties
| Compound Name | Alphacetylmethadol |
| PubChem CID | 22308 |
| Molecular Formula | C23H31NO2 |
| Molecular Weight | 353.50 g/mol |
| Exact Mass | 353.24 |
| IUPAC Name | [(3R,6R)-6-(dimethylamino)-4,4-diphenylheptan-3-yl] acetate |
| SMILES | CC[C@H](C(C[C@@H](C)N(C)C)(C1=CC=CC=C1)C2=CC=CC=C2)OC(=O)C |
| InChI | InChI=1S/C23H31NO2/c1-6-22(26-19(3)25)23(17-18(2)24(4)5,20-13-9-7-10-14-20)21-15-11-8-12-16-21/h7-16,18,22H,6,17H2,1-5H3/t18-,22-/m1/s1 |
| InChIKey | XBMIVRRWGCYBTQ-XMSQKQJNSA-N |
| XLogP | 4.30 |
| TPSA | 29.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | 404 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.50 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze Alphacetylmethadol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Alphacetylmethadol?
The IUPAC name of Alphacetylmethadol (CID 22308) is [(3R,6R)-6-(dimethylamino)-4,4-diphenylheptan-3-yl] acetate.
What is the SMILES notation for Alphacetylmethadol?
The canonical SMILES for Alphacetylmethadol is CC[C@H](C(C[C@@H](C)N(C)C)(C1=CC=CC=C1)C2=CC=CC=C2)OC(=O)C.
What is the InChIKey of Alphacetylmethadol?
The InChIKey is XBMIVRRWGCYBTQ-XMSQKQJNSA-N. The full InChI is InChI=1S/C23H31NO2/c1-6-22(26-19(3)25)23(17-18(2)24(4)5,20-13-9-7-10-14-20)21-15-11-8-12-16-21/h7-16,18,22H,6,17H2,1-5H3/t18-,22-/m1/s1.
What are the key properties of Alphacetylmethadol?
Alphacetylmethadol has a molecular weight of 353.50 g/mol, XLogP of 4.30, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for Alphacetylmethadol is sourced from PubChem (CID 22308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).