C21H29NO — CID 28397
6-(dimethylamino)-4,4-diphenylheptan-3-ol (PubChem CID 28397) has the molecular formula C21H29NO and a molecular weight of 311.47 g/mol. Its IUPAC name is 6-(dimethylamino)-4,4-diphenylheptan-3-ol.
| Compound Name | 6-(dimethylamino)-4,4-diphenylheptan-3-ol |
|---|---|
| PubChem CID | 28397 |
| Molecular Formula | C21H29NO |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.22 |
| IUPAC Name | 6-(dimethylamino)-4,4-diphenylheptan-3-ol |
| SMILES | CCC(O)C(CC(C)N(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H29NO/c1-5-20(23)21(16-17(2)22(3)4,18-12-8-6-9-13-18)19-14-10-7-11-15-19/h6-15,17,20,23H,5,16H2,1-4H3 |
| InChIKey | QIRAYNIFEOXSPW-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |