C23H31NO2 — CID 15130
[(3S,6S)-6-(dimethylamino)-4,4-diphenylheptan-3-yl] acetate (PubChem CID 15130) has the molecular formula C23H31NO2 and a molecular weight of 353.51 g/mol. Its IUPAC name is [(3S,6S)-6-(dimethylamino)-4,4-diphenylheptan-3-yl] acetate.
| Compound Name | [(3S,6S)-6-(dimethylamino)-4,4-diphenylheptan-3-yl] acetate |
|---|---|
| PubChem CID | 15130 |
| Molecular Formula | C23H31NO2 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.24 |
| IUPAC Name | [(3S,6S)-6-(dimethylamino)-4,4-diphenylheptan-3-yl] acetate |
| SMILES | CC[C@H](OC(C)=O)C(C[C@H](C)N(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H31NO2/c1-6-22(26-19(3)25)23(17-18(2)24(4)5,20-13-9-7-10-14-20)21-15-11-8-12-16-21/h7-16,18,22H,6,17H2,1-5H3/t18-,22-/m0/s1 |
| InChIKey | XBMIVRRWGCYBTQ-AVRDEDQJSA-N |
| XLogP | 4.65 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |