About Tilidine Hydrochloride
Tilidine Hydrochloride (PubChem CID 71393) has the molecular formula C17H24ClNO2
and a molecular weight of 309.80 g/mol. Its IUPAC name is ethyl (1S,2R)-2-(dimethylamino)-1-phenylcyclohex-3-ene-1-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | Tilidine Hydrochloride |
| PubChem CID | 71393 |
| Molecular Formula | C17H24ClNO2 |
| Molecular Weight | 309.80 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | ethyl (1S,2R)-2-(dimethylamino)-1-phenylcyclohex-3-ene-1-carboxylate;hydrochloride |
| SMILES | CCOC(=O)[C@@]1(CCC=C[C@H]1N(C)C)C2=CC=CC=C2.Cl |
| InChI | InChI=1S/C17H23NO2.ClH/c1-4-20-16(19)17(14-10-6-5-7-11-14)13-9-8-12-15(17)18(2)3;/h5-8,10-12,15H,4,9,13H2,1-3H3;1H/t15-,17+;/m1./s1 |
| InChIKey | MUWDJVKYGSDUSH-KALLACGZSA-N |
| XLogP | — |
| TPSA | 29.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | 358 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze Tilidine Hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Tilidine Hydrochloride?
The IUPAC name of Tilidine Hydrochloride (CID 71393) is ethyl (1S,2R)-2-(dimethylamino)-1-phenylcyclohex-3-ene-1-carboxylate;hydrochloride.
What is the SMILES notation for Tilidine Hydrochloride?
The canonical SMILES for Tilidine Hydrochloride is CCOC(=O)[C@@]1(CCC=C[C@H]1N(C)C)C2=CC=CC=C2.Cl.
What is the InChIKey of Tilidine Hydrochloride?
The InChIKey is MUWDJVKYGSDUSH-KALLACGZSA-N. The full InChI is InChI=1S/C17H23NO2.ClH/c1-4-20-16(19)17(14-10-6-5-7-11-14)13-9-8-12-15(17)18(2)3;/h5-8,10-12,15H,4,9,13H2,1-3H3;1H/t15-,17+;/m1./s1.
What are the key properties of Tilidine Hydrochloride?
Tilidine Hydrochloride has a molecular weight of 309.80 g/mol, XLogP of not available, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for Tilidine Hydrochloride is sourced from PubChem (CID 71393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).