C16H22O3S — CID 134981803
(4Z,7E)-8-(benzenesulfonyl)-4-methylnona-4,7-dien-3-ol (PubChem CID 134981803) has the molecular formula C16H22O3S and a molecular weight of 294.42 g/mol. Its IUPAC name is (4Z,7E)-8-(benzenesulfonyl)-4-methylnona-4,7-dien-3-ol.
| Compound Name | (4Z,7E)-8-(benzenesulfonyl)-4-methylnona-4,7-dien-3-ol |
|---|---|
| PubChem CID | 134981803 |
| Molecular Formula | C16H22O3S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | (4Z,7E)-8-(benzenesulfonyl)-4-methylnona-4,7-dien-3-ol |
| SMILES | CCC(O)/C(C)=C\C/C=C(\C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H22O3S/c1-4-16(17)13(2)9-8-10-14(3)20(18,19)15-11-6-5-7-12-15/h5-7,9-12,16-17H,4,8H2,1-3H3/b13-9-,14-10+ |
| InChIKey | MXTHNOJCDZEHAN-ZKLMZBBOSA-N |
| XLogP | 3.47 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|