C20H29I2NO2Si — CID 134981860
(Z,2E)-N,N-diethyl-4-iodo-2-[iodo(trimethylsilyl)methylidene]-5-phenylmethoxypent-3-enamide (PubChem CID 134981860) has the molecular formula C20H29I2NO2Si and a molecular weight of 597.35 g/mol. Its IUPAC name is (Z,2E)-N,N-diethyl-4-iodo-2-[iodo(trimethylsilyl)methylidene]-5-phenylmethoxypent-3-enamide.
| Compound Name | (Z,2E)-N,N-diethyl-4-iodo-2-[iodo(trimethylsilyl)methylidene]-5-phenylmethoxypent-3-enamide |
|---|---|
| PubChem CID | 134981860 |
| Molecular Formula | C20H29I2NO2Si |
| Molecular Weight | 597.35 g/mol |
| Exact Mass | 597.01 |
| IUPAC Name | (Z,2E)-N,N-diethyl-4-iodo-2-[iodo(trimethylsilyl)methylidene]-5-phenylmethoxypent-3-enamide |
| SMILES | CCN(CC)C(=O)C(/C=C(\I)COCc1ccccc1)=C(/I)[Si](C)(C)C |
| InChI | InChI=1S/C20H29I2NO2Si/c1-6-23(7-2)20(24)18(19(22)26(3,4)5)13-17(21)15-25-14-16-11-9-8-10-12-16/h8-13H,6-7,14-15H2,1-5H3/b17-13-,19-18- |
| InChIKey | JMLGISOVNDNBGT-PVAPHJRMSA-N |
| XLogP | 5.96 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.35 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|