C27H50O7SSi2 — CID 134982164
(2R,3R,4S)-1-(benzenesulfonylmethyl)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-4-(dimethoxymethyl)cyclopentan-1-ol (PubChem CID 134982164) has the molecular formula C27H50O7SSi2 and a molecular weight of 574.93 g/mol. Its IUPAC name is (2R,3R,4S)-1-(benzenesulfonylmethyl)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-4-(dimethoxymethyl)cyclopentan-1-ol.
| Compound Name | (2R,3R,4S)-1-(benzenesulfonylmethyl)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-4-(dimethoxymethyl)cyclopentan-1-ol |
|---|---|
| PubChem CID | 134982164 |
| Molecular Formula | C27H50O7SSi2 |
| Molecular Weight | 574.93 g/mol |
| Exact Mass | 574.28 |
| IUPAC Name | (2R,3R,4S)-1-(benzenesulfonylmethyl)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-4-(dimethoxymethyl)cyclopentan-1-ol |
| SMILES | COC(OC)[C@H]1CC(O)(CS(=O)(=O)c2ccccc2)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H50O7SSi2/c1-25(2,3)36(9,10)33-22-21(24(31-7)32-8)18-27(28,23(22)34-37(11,12)26(4,5)6)19-35(29,30)20-16-14-13-15-17-20/h13-17,21-24,28H,18-19H2,1-12H3/t21-,22+,23+,27?/m0/s1 |
| InChIKey | WEUJWCGZUUZFGQ-RYMFGWHHSA-N |
| XLogP | 5.61 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.93 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|