C21H36O3 — CID 134982265
methyl 2-[(2R)-6-[(2E,4E)-trideca-2,4-dien-2-yl]oxan-2-yl]acetate (PubChem CID 134982265) has the molecular formula C21H36O3 and a molecular weight of 336.52 g/mol. Its IUPAC name is methyl 2-[(2R)-6-[(2E,4E)-trideca-2,4-dien-2-yl]oxan-2-yl]acetate.
| Compound Name | methyl 2-[(2R)-6-[(2E,4E)-trideca-2,4-dien-2-yl]oxan-2-yl]acetate |
|---|---|
| PubChem CID | 134982265 |
| Molecular Formula | C21H36O3 |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.27 |
| IUPAC Name | methyl 2-[(2R)-6-[(2E,4E)-trideca-2,4-dien-2-yl]oxan-2-yl]acetate |
| SMILES | CCCCCCCC/C=C/C=C(\C)C1CCC[C@H](CC(=O)OC)O1 |
| InChI | InChI=1S/C21H36O3/c1-4-5-6-7-8-9-10-11-12-14-18(2)20-16-13-15-19(24-20)17-21(22)23-3/h11-12,14,19-20H,4-10,13,15-17H2,1-3H3/b12-11+,18-14+/t19-,20?/m1/s1 |
| InChIKey | OMYMBBCMXIRULV-FTTGSOHYSA-N |
| XLogP | 5.74 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|